C9H9BrF2O2 — CID 112560779
1-bromo-3-(3,5-difluorophenoxy)propan-2-ol (PubChem CID 112560779) has the molecular formula C9H9BrF2O2 and a molecular weight of 267.07 g/mol. Its IUPAC name is 1-bromo-3-(3,5-difluorophenoxy)propan-2-ol.
| Compound Name | 1-bromo-3-(3,5-difluorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 112560779 |
| Molecular Formula | C9H9BrF2O2 |
| Molecular Weight | 267.07 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 1-bromo-3-(3,5-difluorophenoxy)propan-2-ol |
| SMILES | OC(CBr)COc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C9H9BrF2O2/c10-4-8(13)5-14-9-2-6(11)1-7(12)3-9/h1-3,8,13H,4-5H2 |
| InChIKey | ATFIGCZOFKMYSP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.07 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|