C10H12F3NO2 — CID 68631534
3-amino-4-(3,5-difluorophenoxy)-1-fluorobutan-2-ol (PubChem CID 68631534) has the molecular formula C10H12F3NO2 and a molecular weight of 235.20 g/mol. Its IUPAC name is 3-amino-4-(3,5-difluorophenoxy)-1-fluorobutan-2-ol.
| Compound Name | 3-amino-4-(3,5-difluorophenoxy)-1-fluorobutan-2-ol |
|---|---|
| PubChem CID | 68631534 |
| Molecular Formula | C10H12F3NO2 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-amino-4-(3,5-difluorophenoxy)-1-fluorobutan-2-ol |
| SMILES | NC(COc1cc(F)cc(F)c1)C(O)CF |
| InChI | InChI=1S/C10H12F3NO2/c11-4-10(15)9(14)5-16-8-2-6(12)1-7(13)3-8/h1-3,9-10,15H,4-5,14H2 |
| InChIKey | DGKPLTQLLPXOLA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |