C14H18F2N2O — CID 91040139
1-N-but-3-yn-2-yl-4-(3,5-difluorophenoxy)butane-1,3-diamine (PubChem CID 91040139) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-N-but-3-yn-2-yl-4-(3,5-difluorophenoxy)butane-1,3-diamine.
| Compound Name | 1-N-but-3-yn-2-yl-4-(3,5-difluorophenoxy)butane-1,3-diamine |
|---|---|
| PubChem CID | 91040139 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-N-but-3-yn-2-yl-4-(3,5-difluorophenoxy)butane-1,3-diamine |
| SMILES | C#CC(C)NCCC(N)COc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H18F2N2O/c1-3-10(2)18-5-4-13(17)9-19-14-7-11(15)6-12(16)8-14/h1,6-8,10,13,18H,4-5,9,17H2,2H3 |
| InChIKey | QPHGGHSCGFMOQT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|