C12H15BrF2O — CID 65010768
1-[2-(bromomethyl)pentoxy]-3,5-difluorobenzene (PubChem CID 65010768) has the molecular formula C12H15BrF2O and a molecular weight of 293.15 g/mol. Its IUPAC name is 1-[2-(bromomethyl)pentoxy]-3,5-difluorobenzene.
| Compound Name | 1-[2-(bromomethyl)pentoxy]-3,5-difluorobenzene |
|---|---|
| PubChem CID | 65010768 |
| Molecular Formula | C12H15BrF2O |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 1-[2-(bromomethyl)pentoxy]-3,5-difluorobenzene |
| SMILES | CCCC(CBr)COc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H15BrF2O/c1-2-3-9(7-13)8-16-12-5-10(14)4-11(15)6-12/h4-6,9H,2-3,7-8H2,1H3 |
| InChIKey | VNGFOKCWERYSAL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|