C11H14Cl2FN — CID 112566767
2-(2,5-dichlorophenyl)-2-fluoro-3-methylbutan-1-amine (PubChem CID 112566767) has the molecular formula C11H14Cl2FN and a molecular weight of 250.14 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-2-fluoro-3-methylbutan-1-amine.
| Compound Name | 2-(2,5-dichlorophenyl)-2-fluoro-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 112566767 |
| Molecular Formula | C11H14Cl2FN |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-2-fluoro-3-methylbutan-1-amine |
| SMILES | CC(C)C(F)(CN)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H14Cl2FN/c1-7(2)11(14,6-15)9-5-8(12)3-4-10(9)13/h3-5,7H,6,15H2,1-2H3 |
| InChIKey | DTRMLLUBYXRSQU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |