C13H26O4S — CID 112570929
2-cyclopentyl-2-(3-ethylsulfonylpropyl)propane-1,3-diol (PubChem CID 112570929) has the molecular formula C13H26O4S and a molecular weight of 278.41 g/mol. Its IUPAC name is 2-cyclopentyl-2-(3-ethylsulfonylpropyl)propane-1,3-diol.
| Compound Name | 2-cyclopentyl-2-(3-ethylsulfonylpropyl)propane-1,3-diol |
|---|---|
| PubChem CID | 112570929 |
| Molecular Formula | C13H26O4S |
| Molecular Weight | 278.41 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-cyclopentyl-2-(3-ethylsulfonylpropyl)propane-1,3-diol |
| SMILES | CCS(=O)(=O)CCCC(CO)(CO)C1CCCC1 |
| InChI | InChI=1S/C13H26O4S/c1-2-18(16,17)9-5-8-13(10-14,11-15)12-6-3-4-7-12/h12,14-15H,2-11H2,1H3 |
| InChIKey | RNYIWNAAMCNIMW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |