C14H20Br2S — CID 112571194
2-[4-bromo-3-(bromomethyl)-3-cyclopentylbutyl]thiophene (PubChem CID 112571194) has the molecular formula C14H20Br2S and a molecular weight of 380.19 g/mol. Its IUPAC name is 2-[4-bromo-3-(bromomethyl)-3-cyclopentylbutyl]thiophene.
| Compound Name | 2-[4-bromo-3-(bromomethyl)-3-cyclopentylbutyl]thiophene |
|---|---|
| PubChem CID | 112571194 |
| Molecular Formula | C14H20Br2S |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 2-[4-bromo-3-(bromomethyl)-3-cyclopentylbutyl]thiophene |
| SMILES | BrCC(CBr)(CCc1cccs1)C1CCCC1 |
| InChI | InChI=1S/C14H20Br2S/c15-10-14(11-16,12-4-1-2-5-12)8-7-13-6-3-9-17-13/h3,6,9,12H,1-2,4-5,7-8,10-11H2 |
| InChIKey | NLGAOQBSFWWLAI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|