C20H25N3O6 — CID 11258178
N-hydroxy-N-[[1-[[(7-methoxy-1-benzofuran-2-carbonyl)amino]carbamoyl]-4-methylcyclohexyl]methyl]formamide (PubChem CID 11258178) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-hydroxy-N-[[1-[[(7-methoxy-1-benzofuran-2-carbonyl)amino]carbamoyl]-4-methylcyclohexyl]methyl]formamide.
| Compound Name | N-hydroxy-N-[[1-[[(7-methoxy-1-benzofuran-2-carbonyl)amino]carbamoyl]-4-methylcyclohexyl]methyl]formamide |
|---|---|
| PubChem CID | 11258178 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-hydroxy-N-[[1-[[(7-methoxy-1-benzofuran-2-carbonyl)amino]carbamoyl]-4-methylcyclohexyl]methyl]formamide |
| SMILES | COc1cccc2cc(C(=O)NNC(=O)C3(CN(O)C=O)CCC(C)CC3)oc12 |
| InChI | InChI=1S/C20H25N3O6/c1-13-6-8-20(9-7-13,11-23(27)12-24)19(26)22-21-18(25)16-10-14-4-3-5-15(28-2)17(14)29-16/h3-5,10,12-13,27H,6-9,11H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | GJWVUTNIPKZWEH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|