C21H19NO6S — CID 11258464
2-[5-[2-[3-(3,4,5-trihydroxyphenyl)propanoylamino]phenyl]thiophen-2-yl]acetic acid (PubChem CID 11258464) has the molecular formula C21H19NO6S and a molecular weight of 413.45 g/mol. Its IUPAC name is 2-[5-[2-[3-(3,4,5-trihydroxyphenyl)propanoylamino]phenyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[2-[3-(3,4,5-trihydroxyphenyl)propanoylamino]phenyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 11258464 |
| Molecular Formula | C21H19NO6S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-[5-[2-[3-(3,4,5-trihydroxyphenyl)propanoylamino]phenyl]thiophen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(-c2ccccc2NC(=O)CCc2cc(O)c(O)c(O)c2)s1 |
| InChI | InChI=1S/C21H19NO6S/c23-16-9-12(10-17(24)21(16)28)5-8-19(25)22-15-4-2-1-3-14(15)18-7-6-13(29-18)11-20(26)27/h1-4,6-7,9-10,23-24,28H,5,8,11H2,(H,22,25)(H,26,27) |
| InChIKey | KBSJBLIFCLOXMF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|