C23H20N2O7 — CID 59594904
2-[3-[2-[3-(3,4-dihydroxy-5-nitrophenyl)propanoylamino]phenyl]phenyl]acetic acid (PubChem CID 59594904) has the molecular formula C23H20N2O7 and a molecular weight of 436.42 g/mol. Its IUPAC name is 2-[3-[2-[3-(3,4-dihydroxy-5-nitrophenyl)propanoylamino]phenyl]phenyl]acetic acid.
| Compound Name | 2-[3-[2-[3-(3,4-dihydroxy-5-nitrophenyl)propanoylamino]phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 59594904 |
| Molecular Formula | C23H20N2O7 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-[3-[2-[3-(3,4-dihydroxy-5-nitrophenyl)propanoylamino]phenyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(-c2ccccc2NC(=O)CCc2cc(O)c(O)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C23H20N2O7/c26-20-12-15(11-19(23(20)30)25(31)32)8-9-21(27)24-18-7-2-1-6-17(18)16-5-3-4-14(10-16)13-22(28)29/h1-7,10-12,26,30H,8-9,13H2,(H,24,27)(H,28,29) |
| InChIKey | HDRQJTJMLBMJEA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|