C24H24N2O7 — CID 89366686
(3Z)-3-[(E)-2-[2-[3-(3,4-dihydroxy-5-nitrophenyl)propanoylamino]phenyl]prop-1-enyl]hexa-3,5-dienoic acid (PubChem CID 89366686) has the molecular formula C24H24N2O7 and a molecular weight of 452.46 g/mol. Its IUPAC name is (3Z)-3-[(E)-2-[2-[3-(3,4-dihydroxy-5-nitrophenyl)propanoylamino]phenyl]prop-1-enyl]hexa-3,5-dienoic acid.
| Compound Name | (3Z)-3-[(E)-2-[2-[3-(3,4-dihydroxy-5-nitrophenyl)propanoylamino]phenyl]prop-1-enyl]hexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 89366686 |
| Molecular Formula | C24H24N2O7 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | (3Z)-3-[(E)-2-[2-[3-(3,4-dihydroxy-5-nitrophenyl)propanoylamino]phenyl]prop-1-enyl]hexa-3,5-dienoic acid |
| SMILES | C=C/C=C(\C=C(/C)c1ccccc1NC(=O)CCc1cc(O)c(O)c([N+](=O)[O-])c1)CC(=O)O |
| InChI | InChI=1S/C24H24N2O7/c1-3-6-16(14-23(29)30)11-15(2)18-7-4-5-8-19(18)25-22(28)10-9-17-12-20(26(32)33)24(31)21(27)13-17/h3-8,11-13,27,31H,1,9-10,14H2,2H3,(H,25,28)(H,29,30)/b15-11+,16-6+ |
| InChIKey | TYMXGFMUWWWXMM-YDGYGYSFSA-N |
| XLogP | 4.57 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|