C10H21N5 — CID 112597470
5-(4-aminobutan-2-yl)-N,4-diethyl-1,2,4-triazol-3-amine (PubChem CID 112597470) has the molecular formula C10H21N5 and a molecular weight of 211.31 g/mol. Its IUPAC name is 5-(4-aminobutan-2-yl)-N,4-diethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(4-aminobutan-2-yl)-N,4-diethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112597470 |
| Molecular Formula | C10H21N5 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.18 |
| IUPAC Name | 5-(4-aminobutan-2-yl)-N,4-diethyl-1,2,4-triazol-3-amine |
| SMILES | CCNc1nnc(C(C)CCN)n1CC |
| InChI | InChI=1S/C10H21N5/c1-4-12-10-14-13-9(15(10)5-2)8(3)6-7-11/h8H,4-7,11H2,1-3H3,(H,12,14) |
| InChIKey | DUTSKADLRJHICX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |