C6H13N5 — CID 112597568
3-N,4-diethyl-1,2,4-triazole-3,5-diamine (PubChem CID 112597568) has the molecular formula C6H13N5 and a molecular weight of 155.20 g/mol. Its IUPAC name is 3-N,4-diethyl-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N,4-diethyl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 112597568 |
| Molecular Formula | C6H13N5 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.12 |
| IUPAC Name | 3-N,4-diethyl-1,2,4-triazole-3,5-diamine |
| SMILES | CCNc1nnc(N)n1CC |
| InChI | InChI=1S/C6H13N5/c1-3-8-6-10-9-5(7)11(6)4-2/h3-4H2,1-2H3,(H2,7,9)(H,8,10) |
| InChIKey | HVXIWJIPBSHEIJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |