C9H17N5 — CID 112597567
5-(azetidin-3-yl)-N,4-diethyl-1,2,4-triazol-3-amine (PubChem CID 112597567) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 5-(azetidin-3-yl)-N,4-diethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(azetidin-3-yl)-N,4-diethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112597567 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 5-(azetidin-3-yl)-N,4-diethyl-1,2,4-triazol-3-amine |
| SMILES | CCNc1nnc(C2CNC2)n1CC |
| InChI | InChI=1S/C9H17N5/c1-3-11-9-13-12-8(14(9)4-2)7-5-10-6-7/h7,10H,3-6H2,1-2H3,(H,11,13) |
| InChIKey | KPIMYIKUSVHXTN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |