C11H21N5 — CID 112597415
N,4-diethyl-5-piperidin-4-yl-1,2,4-triazol-3-amine (PubChem CID 112597415) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is N,4-diethyl-5-piperidin-4-yl-1,2,4-triazol-3-amine.
| Compound Name | N,4-diethyl-5-piperidin-4-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112597415 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | N,4-diethyl-5-piperidin-4-yl-1,2,4-triazol-3-amine |
| SMILES | CCNc1nnc(C2CCNCC2)n1CC |
| InChI | InChI=1S/C11H21N5/c1-3-13-11-15-14-10(16(11)4-2)9-5-7-12-8-6-9/h9,12H,3-8H2,1-2H3,(H,13,15) |
| InChIKey | LXZIDVMCYIJYKW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |