C11H9FN2O4 — CID 112598115
1-(2-fluoro-5-methoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 112598115) has the molecular formula C11H9FN2O4 and a molecular weight of 252.20 g/mol. Its IUPAC name is 1-(2-fluoro-5-methoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(2-fluoro-5-methoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 112598115 |
| Molecular Formula | C11H9FN2O4 |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1-(2-fluoro-5-methoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(F)c(N2C(=O)CC(=O)NC2=O)c1 |
| InChI | InChI=1S/C11H9FN2O4/c1-18-6-2-3-7(12)8(4-6)14-10(16)5-9(15)13-11(14)17/h2-4H,5H2,1H3,(H,13,15,17) |
| InChIKey | XUKZDEGMXXNZRC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|