C13H13N3O3 — CID 112599586
7-(2-pyridin-4-ylethyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione (PubChem CID 112599586) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 7-(2-pyridin-4-ylethyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione.
| Compound Name | 7-(2-pyridin-4-ylethyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione |
|---|---|
| PubChem CID | 112599586 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 7-(2-pyridin-4-ylethyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione |
| SMILES | O=C1NC(=O)C2(CC2)C(=O)N1CCc1ccncc1 |
| InChI | InChI=1S/C13H13N3O3/c17-10-13(4-5-13)11(18)16(12(19)15-10)8-3-9-1-6-14-7-2-9/h1-2,6-7H,3-5,8H2,(H,15,17,19) |
| InChIKey | OIRBIXZRPDIFMR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|