C27H25N3O5 — CID 2947695
5-(1,3-benzodioxol-5-ylmethyl)-1-(2-phenylethyl)-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 2947695) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethyl)-1-(2-phenylethyl)-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethyl)-1-(2-phenylethyl)-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2947695 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethyl)-1-(2-phenylethyl)-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(CCc2ccncc2)(Cc2ccc3c(c2)OCO3)C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C27H25N3O5/c31-24-27(12-8-20-9-13-28-14-10-20,17-21-6-7-22-23(16-21)35-18-34-22)25(32)30(26(33)29-24)15-11-19-4-2-1-3-5-19/h1-7,9-10,13-14,16H,8,11-12,15,17-18H2,(H,29,31,33) |
| InChIKey | WSRKMWCLIUIOLB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|