C11H17N3O3 — CID 112600075
5,5-dimethyl-1-(1-methylpyrrolidin-3-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 112600075) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 5,5-dimethyl-1-(1-methylpyrrolidin-3-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-dimethyl-1-(1-methylpyrrolidin-3-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 112600075 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 5,5-dimethyl-1-(1-methylpyrrolidin-3-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | CN1CCC(N2C(=O)NC(=O)C(C)(C)C2=O)C1 |
| InChI | InChI=1S/C11H17N3O3/c1-11(2)8(15)12-10(17)14(9(11)16)7-4-5-13(3)6-7/h7H,4-6H2,1-3H3,(H,12,15,17) |
| InChIKey | LPZAVZUUOQJBFH-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|