C14H19N3O3 — CID 115947312
8-(1-cyclopropylpyrrolidin-3-yl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione (PubChem CID 115947312) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 8-(1-cyclopropylpyrrolidin-3-yl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione.
| Compound Name | 8-(1-cyclopropylpyrrolidin-3-yl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione |
|---|---|
| PubChem CID | 115947312 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 8-(1-cyclopropylpyrrolidin-3-yl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione |
| SMILES | O=C1NC(=O)C2(CCC2)C(=O)N1C1CCN(C2CC2)C1 |
| InChI | InChI=1S/C14H19N3O3/c18-11-14(5-1-6-14)12(19)17(13(20)15-11)10-4-7-16(8-10)9-2-3-9/h9-10H,1-8H2,(H,15,18,20) |
| InChIKey | UNWHXFZWQMSFPG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|