C11H13N3O4 — CID 112600414
7-(2-oxopiperidin-3-yl)-5,7-diazaspiro[2.5]octane-4,6,8-trione (PubChem CID 112600414) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 7-(2-oxopiperidin-3-yl)-5,7-diazaspiro[2.5]octane-4,6,8-trione.
| Compound Name | 7-(2-oxopiperidin-3-yl)-5,7-diazaspiro[2.5]octane-4,6,8-trione |
|---|---|
| PubChem CID | 112600414 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 7-(2-oxopiperidin-3-yl)-5,7-diazaspiro[2.5]octane-4,6,8-trione |
| SMILES | O=C1NCCCC1N1C(=O)NC(=O)C2(CC2)C1=O |
| InChI | InChI=1S/C11H13N3O4/c15-7-6(2-1-5-12-7)14-9(17)11(3-4-11)8(16)13-10(14)18/h6H,1-5H2,(H,12,15)(H,13,16,18) |
| InChIKey | CELATMXXBUYGDG-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|