C27H30O11S — CID 11261526
(1R,2R,3S,4R)-7-methoxy-2,3,4-tris(methoxymethoxy)-1-phenylsulfanyl-1,2,3,4-tetrahydro-[1,3]benzodioxolo[5,6-c]chromen-6-one (PubChem CID 11261526) has the molecular formula C27H30O11S and a molecular weight of 562.59 g/mol. Its IUPAC name is (1R,2R,3S,4R)-7-methoxy-2,3,4-tris(methoxymethoxy)-1-phenylsulfanyl-1,2,3,4-tetrahydro-[1,3]benzodioxolo[5,6-c]chromen-6-one.
| Compound Name | (1R,2R,3S,4R)-7-methoxy-2,3,4-tris(methoxymethoxy)-1-phenylsulfanyl-1,2,3,4-tetrahydro-[1,3]benzodioxolo[5,6-c]chromen-6-one |
|---|---|
| PubChem CID | 11261526 |
| Molecular Formula | C27H30O11S |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | (1R,2R,3S,4R)-7-methoxy-2,3,4-tris(methoxymethoxy)-1-phenylsulfanyl-1,2,3,4-tetrahydro-[1,3]benzodioxolo[5,6-c]chromen-6-one |
| SMILES | COCO[C@@H]1[C@@H](OCOC)[C@@H](OCOC)c2oc(=O)c3c(OC)c4c(cc3c2[C@H]1Sc1ccccc1)OCO4 |
| InChI | InChI=1S/C27H30O11S/c1-29-11-34-23-22-18(16-10-17-20(37-14-33-17)21(32-4)19(16)27(28)38-22)26(39-15-8-6-5-7-9-15)25(36-13-31-3)24(23)35-12-30-2/h5-10,23-26H,11-14H2,1-4H3/t23-,24-,25+,26+/m0/s1 |
| InChIKey | AUDCPULNEOGOBF-QEGGNFSNSA-N |
| XLogP | 4.02 |
| TPSA | 113.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|