C28H30O5 — CID 71498941
(E)-7-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-1,1-diphenylhept-6-en-1-ol (PubChem CID 71498941) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is (E)-7-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-1,1-diphenylhept-6-en-1-ol.
| Compound Name | (E)-7-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-1,1-diphenylhept-6-en-1-ol |
|---|---|
| PubChem CID | 71498941 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (E)-7-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-1,1-diphenylhept-6-en-1-ol |
| SMILES | COc1c(/C=C/CCCCC(O)(c2ccccc2)c2ccccc2)cc2c(c1OC)OCO2 |
| InChI | InChI=1S/C28H30O5/c1-30-25-21(19-24-26(27(25)31-2)33-20-32-24)13-7-3-4-12-18-28(29,22-14-8-5-9-15-22)23-16-10-6-11-17-23/h5-11,13-17,19,29H,3-4,12,18,20H2,1-2H3/b13-7+ |
| InChIKey | NEZYINPFWYMEFB-NTUHNPAUSA-N |
| XLogP | 5.94 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|