C12H12BrNOS2 — CID 112642586
1-(2-bromophenyl)sulfanyl-3-(1,3-thiazol-5-yl)propan-2-ol (PubChem CID 112642586) has the molecular formula C12H12BrNOS2 and a molecular weight of 330.27 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfanyl-3-(1,3-thiazol-5-yl)propan-2-ol.
| Compound Name | 1-(2-bromophenyl)sulfanyl-3-(1,3-thiazol-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 112642586 |
| Molecular Formula | C12H12BrNOS2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 328.95 |
| IUPAC Name | 1-(2-bromophenyl)sulfanyl-3-(1,3-thiazol-5-yl)propan-2-ol |
| SMILES | OC(CSc1ccccc1Br)Cc1cncs1 |
| InChI | InChI=1S/C12H12BrNOS2/c13-11-3-1-2-4-12(11)16-7-9(15)5-10-6-14-8-17-10/h1-4,6,8-9,15H,5,7H2 |
| InChIKey | BGNIUQCTOIERRZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |