C13H21N3S — CID 112644971
5-(6,10-diazaspiro[4.6]undecan-10-ylmethyl)-1,3-thiazole (PubChem CID 112644971) has the molecular formula C13H21N3S and a molecular weight of 251.40 g/mol. Its IUPAC name is 5-(6,10-diazaspiro[4.6]undecan-10-ylmethyl)-1,3-thiazole.
| Compound Name | 5-(6,10-diazaspiro[4.6]undecan-10-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 112644971 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 5-(6,10-diazaspiro[4.6]undecan-10-ylmethyl)-1,3-thiazole |
| SMILES | c1ncc(CN2CCCNC3(CCCC3)C2)s1 |
| InChI | InChI=1S/C13H21N3S/c1-2-5-13(4-1)10-16(7-3-6-15-13)9-12-8-14-11-17-12/h8,11,15H,1-7,9-10H2 |
| InChIKey | QZOSYCQMRCVXHD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |