C8H14N2OS2 — CID 112645670
4-(1,3-thiazol-5-ylmethylsulfinyl)butan-2-amine (PubChem CID 112645670) has the molecular formula C8H14N2OS2 and a molecular weight of 218.35 g/mol. Its IUPAC name is 4-(1,3-thiazol-5-ylmethylsulfinyl)butan-2-amine.
| Compound Name | 4-(1,3-thiazol-5-ylmethylsulfinyl)butan-2-amine |
|---|---|
| PubChem CID | 112645670 |
| Molecular Formula | C8H14N2OS2 |
| Molecular Weight | 218.35 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 4-(1,3-thiazol-5-ylmethylsulfinyl)butan-2-amine |
| SMILES | CC(N)CCS(=O)Cc1cncs1 |
| InChI | InChI=1S/C8H14N2OS2/c1-7(9)2-3-13(11)5-8-4-10-6-12-8/h4,6-7H,2-3,5,9H2,1H3 |
| InChIKey | MWEXTYUXPZXLLA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |