C11H13N3S2 — CID 112648832
3-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-5-methylaniline (PubChem CID 112648832) has the molecular formula C11H13N3S2 and a molecular weight of 251.38 g/mol. Its IUPAC name is 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-5-methylaniline.
| Compound Name | 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-5-methylaniline |
|---|---|
| PubChem CID | 112648832 |
| Molecular Formula | C11H13N3S2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-5-methylaniline |
| SMILES | CCc1nsc(Sc2cc(C)cc(N)c2)n1 |
| InChI | InChI=1S/C11H13N3S2/c1-3-10-13-11(16-14-10)15-9-5-7(2)4-8(12)6-9/h4-6H,3,12H2,1-2H3 |
| InChIKey | JZDIOMBOMQIVSM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|