C29H16N2O7 — CID 1126512
2-(2-hydroxyphenyl)-5-[2-(2-hydroxyphenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione (PubChem CID 1126512) has the molecular formula C29H16N2O7 and a molecular weight of 504.45 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-5-[2-(2-hydroxyphenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-(2-hydroxyphenyl)-5-[2-(2-hydroxyphenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1126512 |
| Molecular Formula | C29H16N2O7 |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 2-(2-hydroxyphenyl)-5-[2-(2-hydroxyphenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccc2c(c1)C(=O)N(c1ccccc1O)C2=O)c1ccc2c(c1)C(=O)N(c1ccccc1O)C2=O |
| InChI | InChI=1S/C29H16N2O7/c32-23-7-3-1-5-21(23)30-26(35)17-11-9-15(13-19(17)28(30)37)25(34)16-10-12-18-20(14-16)29(38)31(27(18)36)22-6-2-4-8-24(22)33/h1-14,32-33H |
| InChIKey | PBHXDSQOYKBFAU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|