C12H20N2S — CID 112657053
3-N,5-dimethyl-3-N-(1-methylsulfanylpropan-2-yl)benzene-1,3-diamine (PubChem CID 112657053) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 3-N,5-dimethyl-3-N-(1-methylsulfanylpropan-2-yl)benzene-1,3-diamine.
| Compound Name | 3-N,5-dimethyl-3-N-(1-methylsulfanylpropan-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 112657053 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-N,5-dimethyl-3-N-(1-methylsulfanylpropan-2-yl)benzene-1,3-diamine |
| SMILES | CSCC(C)N(C)c1cc(C)cc(N)c1 |
| InChI | InChI=1S/C12H20N2S/c1-9-5-11(13)7-12(6-9)14(3)10(2)8-15-4/h5-7,10H,8,13H2,1-4H3 |
| InChIKey | CFXWIHGPCRUOOZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|