C13H19F3N2S — CID 112662366
4-(aminomethyl)-N-methyl-N-(1-methylsulfanylpropan-2-yl)-2-(trifluoromethyl)aniline (PubChem CID 112662366) has the molecular formula C13H19F3N2S and a molecular weight of 292.37 g/mol. Its IUPAC name is 4-(aminomethyl)-N-methyl-N-(1-methylsulfanylpropan-2-yl)-2-(trifluoromethyl)aniline.
| Compound Name | 4-(aminomethyl)-N-methyl-N-(1-methylsulfanylpropan-2-yl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 112662366 |
| Molecular Formula | C13H19F3N2S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 4-(aminomethyl)-N-methyl-N-(1-methylsulfanylpropan-2-yl)-2-(trifluoromethyl)aniline |
| SMILES | CSCC(C)N(C)c1ccc(CN)cc1C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2S/c1-9(8-19-3)18(2)12-5-4-10(7-17)6-11(12)13(14,15)16/h4-6,9H,7-8,17H2,1-3H3 |
| InChIKey | GZKMCFNKRBDRBP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |