C18H26O4 — CID 11266763
methyl 11,14,14-trimethyl-1,4-dioxadispiro[4.2.58.25]pentadeca-6,10-diene-7-carboxylate (PubChem CID 11266763) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is methyl 11,14,14-trimethyl-1,4-dioxadispiro[4.2.58.25]pentadeca-6,10-diene-7-carboxylate.
| Compound Name | methyl 11,14,14-trimethyl-1,4-dioxadispiro[4.2.58.25]pentadeca-6,10-diene-7-carboxylate |
|---|---|
| PubChem CID | 11266763 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | methyl 11,14,14-trimethyl-1,4-dioxadispiro[4.2.58.25]pentadeca-6,10-diene-7-carboxylate |
| SMILES | COC(=O)C1=CC2(CC(C)(C)C13CC=C(C)CC3)OCCO2 |
| InChI | InChI=1S/C18H26O4/c1-13-5-7-17(8-6-13)14(15(19)20-4)11-18(12-16(17,2)3)21-9-10-22-18/h5,11H,6-10,12H2,1-4H3 |
| InChIKey | OUGDNPPWBQCRPW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|