dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate

C12H16O6 — CID 121003810

IUPACdimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate
SMILESCOC(=O)C1(C(=O)OC)CC=CC2(C1)OCCO2
InChIInChI=1S/C12H16O6/c1-15-9(13)11(10(14)16-2)4-3-5-12(8-11)17-6-7-18-12/h3,5H,4,6-8H2,1-2H3
InChIKeyPJSHFLGYFTWNGH-UHFFFAOYSA-N
MW256.25 g/mol
LogP0.41
Rot. Bonds2

About dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate

dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate (PubChem CID 121003810) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate.

Molecular Properties

Compound Namedimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate
PubChem CID121003810
Molecular FormulaC12H16O6
Molecular Weight256.25 g/mol
Exact Mass256.09
IUPAC Namedimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate
SMILESCOC(=O)C1(C(=O)OC)CC=CC2(C1)OCCO2
InChIInChI=1S/C12H16O6/c1-15-9(13)11(10(14)16-2)4-3-5-12(8-11)17-6-7-18-12/h3,5H,4,6-8H2,1-2H3
InChIKeyPJSHFLGYFTWNGH-UHFFFAOYSA-N
XLogP0.41
TPSA71.06 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.25
LogP ≤ 50.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate?
The IUPAC name of dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate (CID 121003810) is dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate.
What is the SMILES notation for dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate?
The canonical SMILES for dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate is COC(=O)C1(C(=O)OC)CC=CC2(C1)OCCO2.
What is the InChIKey of dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate?
The InChIKey is PJSHFLGYFTWNGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O6/c1-15-9(13)11(10(14)16-2)4-3-5-12(8-11)17-6-7-18-12/h3,5H,4,6-8H2,1-2H3.
What are the key properties of dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate?
dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate has a molecular weight of 256.25 g/mol, XLogP of 0.41, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate is sourced from PubChem (CID 121003810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).