C12H16O6 — CID 121003810
dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate (PubChem CID 121003810) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate.
| Compound Name | dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate |
|---|---|
| PubChem CID | 121003810 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | dimethyl 1,4-dioxaspiro[4.5]dec-6-ene-9,9-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC=CC2(C1)OCCO2 |
| InChI | InChI=1S/C12H16O6/c1-15-9(13)11(10(14)16-2)4-3-5-12(8-11)17-6-7-18-12/h3,5H,4,6-8H2,1-2H3 |
| InChIKey | PJSHFLGYFTWNGH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|