C19H35NO2 — CID 11266868
tert-butyl (10Z)-1-azacyclopentadec-10-ene-1-carboxylate (PubChem CID 11266868) has the molecular formula C19H35NO2 and a molecular weight of 309.49 g/mol. Its IUPAC name is tert-butyl (10Z)-1-azacyclopentadec-10-ene-1-carboxylate.
| Compound Name | tert-butyl (10Z)-1-azacyclopentadec-10-ene-1-carboxylate |
|---|---|
| PubChem CID | 11266868 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | tert-butyl (10Z)-1-azacyclopentadec-10-ene-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC/C=C\CCCCCCCC1 |
| InChI | InChI=1S/C19H35NO2/c1-19(2,3)22-18(21)20-16-14-12-10-8-6-4-5-7-9-11-13-15-17-20/h6,8H,4-5,7,9-17H2,1-3H3/b8-6- |
| InChIKey | OHMKROLYWGQESQ-VURMDHGXSA-N |
| XLogP | 5.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|