C7H9N3S — CID 112670110
4-(isothiocyanatomethyl)-1,3-dimethylpyrazole (PubChem CID 112670110) has the molecular formula C7H9N3S and a molecular weight of 167.24 g/mol. Its IUPAC name is 4-(isothiocyanatomethyl)-1,3-dimethylpyrazole.
| Compound Name | 4-(isothiocyanatomethyl)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 112670110 |
| Molecular Formula | C7H9N3S |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 4-(isothiocyanatomethyl)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)cc1CN=C=S |
| InChI | InChI=1S/C7H9N3S/c1-6-7(3-8-5-11)4-10(2)9-6/h4H,3H2,1-2H3 |
| InChIKey | HBBCOFMZOQPASO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|