C11H22N4O3 — CID 112672524
2-[4-[(2-amino-2-oxoethoxy)amino]piperidin-1-yl]-N,N-dimethylacetamide (PubChem CID 112672524) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[4-[(2-amino-2-oxoethoxy)amino]piperidin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[(2-amino-2-oxoethoxy)amino]piperidin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 112672524 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-[4-[(2-amino-2-oxoethoxy)amino]piperidin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCC(NOCC(N)=O)CC1 |
| InChI | InChI=1S/C11H22N4O3/c1-14(2)11(17)7-15-5-3-9(4-6-15)13-18-8-10(12)16/h9,13H,3-8H2,1-2H3,(H2,12,16) |
| InChIKey | GELLNFWWMXEHMB-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|