C18H16FNO4 — CID 11267473
(5-fluoroindol-1-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 11267473) has the molecular formula C18H16FNO4 and a molecular weight of 329.33 g/mol. Its IUPAC name is (5-fluoroindol-1-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (5-fluoroindol-1-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 11267473 |
| Molecular Formula | C18H16FNO4 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (5-fluoroindol-1-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)n2ccc3cc(F)ccc32)cc(OC)c1OC |
| InChI | InChI=1S/C18H16FNO4/c1-22-15-9-12(10-16(23-2)17(15)24-3)18(21)20-7-6-11-8-13(19)4-5-14(11)20/h4-10H,1-3H3 |
| InChIKey | AXWJHPVIOCBDDX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |