C12H17F2N3 — CID 112676008
N-(1,2-dimethylpiperidin-4-yl)-3,5-difluoropyridin-2-amine (PubChem CID 112676008) has the molecular formula C12H17F2N3 and a molecular weight of 241.28 g/mol. Its IUPAC name is N-(1,2-dimethylpiperidin-4-yl)-3,5-difluoropyridin-2-amine.
| Compound Name | N-(1,2-dimethylpiperidin-4-yl)-3,5-difluoropyridin-2-amine |
|---|---|
| PubChem CID | 112676008 |
| Molecular Formula | C12H17F2N3 |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | N-(1,2-dimethylpiperidin-4-yl)-3,5-difluoropyridin-2-amine |
| SMILES | CC1CC(Nc2ncc(F)cc2F)CCN1C |
| InChI | InChI=1S/C12H17F2N3/c1-8-5-10(3-4-17(8)2)16-12-11(14)6-9(13)7-15-12/h6-8,10H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | GDHQDACLQVKTHF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |