C21H32O4 — CID 11268079
1-[(1S,2E,4E,8E,12S,13R)-13-(methoxymethoxy)-5,9,13-trimethyl-15-oxabicyclo[10.2.1]pentadeca-2,4,8-trien-2-yl]ethanone (PubChem CID 11268079) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 1-[(1S,2E,4E,8E,12S,13R)-13-(methoxymethoxy)-5,9,13-trimethyl-15-oxabicyclo[10.2.1]pentadeca-2,4,8-trien-2-yl]ethanone.
| Compound Name | 1-[(1S,2E,4E,8E,12S,13R)-13-(methoxymethoxy)-5,9,13-trimethyl-15-oxabicyclo[10.2.1]pentadeca-2,4,8-trien-2-yl]ethanone |
|---|---|
| PubChem CID | 11268079 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 1-[(1S,2E,4E,8E,12S,13R)-13-(methoxymethoxy)-5,9,13-trimethyl-15-oxabicyclo[10.2.1]pentadeca-2,4,8-trien-2-yl]ethanone |
| SMILES | COCO[C@]1(C)C[C@@H]2O[C@H]1CC/C(C)=C/CC/C(C)=C/C=C\2C(C)=O |
| InChI | InChI=1S/C21H32O4/c1-15-7-6-8-16(2)10-12-20-21(4,24-14-23-5)13-19(25-20)18(11-9-15)17(3)22/h8-9,11,19-20H,6-7,10,12-14H2,1-5H3/b15-9+,16-8+,18-11-/t19-,20-,21+/m0/s1 |
| InChIKey | BQSKSHLMLRJNSP-MBICFEPDSA-N |
| XLogP | 4.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|