C25H21NO — CID 11268172
(3S,11bR)-3,6-diphenyl-1,2,3,11b-tetrahydropyrrolo[2,1-a][2]benzazepin-5-one (PubChem CID 11268172) has the molecular formula C25H21NO and a molecular weight of 351.45 g/mol. Its IUPAC name is (3S,11bR)-3,6-diphenyl-1,2,3,11b-tetrahydropyrrolo[2,1-a][2]benzazepin-5-one.
| Compound Name | (3S,11bR)-3,6-diphenyl-1,2,3,11b-tetrahydropyrrolo[2,1-a][2]benzazepin-5-one |
|---|---|
| PubChem CID | 11268172 |
| Molecular Formula | C25H21NO |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (3S,11bR)-3,6-diphenyl-1,2,3,11b-tetrahydropyrrolo[2,1-a][2]benzazepin-5-one |
| SMILES | O=C1C(c2ccccc2)=Cc2ccccc2[C@H]2CC[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C25H21NO/c27-25-22(18-9-3-1-4-10-18)17-20-13-7-8-14-21(20)24-16-15-23(26(24)25)19-11-5-2-6-12-19/h1-14,17,23-24H,15-16H2/t23-,24+/m0/s1 |
| InChIKey | DFEZOJAELNBFRI-BJKOFHAPSA-N |
| XLogP | 5.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|