C30H22N2O4S2 — CID 88841009
11-[4-(10,12-dioxo-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraen-11-yl)cyclohexyl]-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraene-10,12-dione (PubChem CID 88841009) has the molecular formula C30H22N2O4S2 and a molecular weight of 538.65 g/mol. Its IUPAC name is 11-[4-(10,12-dioxo-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraen-11-yl)cyclohexyl]-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraene-10,12-dione.
| Compound Name | 11-[4-(10,12-dioxo-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraen-11-yl)cyclohexyl]-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 88841009 |
| Molecular Formula | C30H22N2O4S2 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | 11-[4-(10,12-dioxo-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraen-11-yl)cyclohexyl]-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraene-10,12-dione |
| SMILES | O=C1C2=Cc3ccccc3C(C(=O)N1C1CCC(N3C(=O)C4=Cc5ccccc5C(C3=O)C4=S)CC1)C2=S |
| InChI | InChI=1S/C30H22N2O4S2/c33-27-21-13-15-5-1-3-7-19(15)23(25(21)37)29(35)31(27)17-9-11-18(12-10-17)32-28(34)22-14-16-6-2-4-8-20(16)24(26(22)38)30(32)36/h1-8,13-14,17-18,23-24H,9-12H2 |
| InChIKey | VIWWHDXSMHIOOG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|