C17H25BrO — CID 112682706
1-[(4-bromophenyl)methyl]-3,3,5,5-tetramethylcyclohexan-1-ol (PubChem CID 112682706) has the molecular formula C17H25BrO and a molecular weight of 325.29 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3,3,5,5-tetramethylcyclohexan-1-ol.
| Compound Name | 1-[(4-bromophenyl)methyl]-3,3,5,5-tetramethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 112682706 |
| Molecular Formula | C17H25BrO |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3,3,5,5-tetramethylcyclohexan-1-ol |
| SMILES | CC1(C)CC(C)(C)CC(O)(Cc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C17H25BrO/c1-15(2)10-16(3,4)12-17(19,11-15)9-13-5-7-14(18)8-6-13/h5-8,19H,9-12H2,1-4H3 |
| InChIKey | NKESXNHABXXKTM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |