C17H26OS — CID 79947185
5,5-dimethyl-3-[(4-propan-2-ylphenyl)methyl]thian-3-ol (PubChem CID 79947185) has the molecular formula C17H26OS and a molecular weight of 278.46 g/mol. Its IUPAC name is 5,5-dimethyl-3-[(4-propan-2-ylphenyl)methyl]thian-3-ol.
| Compound Name | 5,5-dimethyl-3-[(4-propan-2-ylphenyl)methyl]thian-3-ol |
|---|---|
| PubChem CID | 79947185 |
| Molecular Formula | C17H26OS |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 5,5-dimethyl-3-[(4-propan-2-ylphenyl)methyl]thian-3-ol |
| SMILES | CC(C)c1ccc(CC2(O)CSCC(C)(C)C2)cc1 |
| InChI | InChI=1S/C17H26OS/c1-13(2)15-7-5-14(6-8-15)9-17(18)10-16(3,4)11-19-12-17/h5-8,13,18H,9-12H2,1-4H3 |
| InChIKey | WKYFTQBRWUFSAX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |