C16H24OS — CID 79947093
3-[(4-ethylphenyl)methyl]-5,5-dimethylthian-3-ol (PubChem CID 79947093) has the molecular formula C16H24OS and a molecular weight of 264.43 g/mol. Its IUPAC name is 3-[(4-ethylphenyl)methyl]-5,5-dimethylthian-3-ol.
| Compound Name | 3-[(4-ethylphenyl)methyl]-5,5-dimethylthian-3-ol |
|---|---|
| PubChem CID | 79947093 |
| Molecular Formula | C16H24OS |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-[(4-ethylphenyl)methyl]-5,5-dimethylthian-3-ol |
| SMILES | CCc1ccc(CC2(O)CSCC(C)(C)C2)cc1 |
| InChI | InChI=1S/C16H24OS/c1-4-13-5-7-14(8-6-13)9-16(17)10-15(2,3)11-18-12-16/h5-8,17H,4,9-12H2,1-3H3 |
| InChIKey | HCWDQRINXXIMTQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |