C14H19IO — CID 80699119
1-[(4-iodophenyl)methyl]-3,3-dimethylcyclopentan-1-ol (PubChem CID 80699119) has the molecular formula C14H19IO and a molecular weight of 330.21 g/mol. Its IUPAC name is 1-[(4-iodophenyl)methyl]-3,3-dimethylcyclopentan-1-ol.
| Compound Name | 1-[(4-iodophenyl)methyl]-3,3-dimethylcyclopentan-1-ol |
|---|---|
| PubChem CID | 80699119 |
| Molecular Formula | C14H19IO |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 1-[(4-iodophenyl)methyl]-3,3-dimethylcyclopentan-1-ol |
| SMILES | CC1(C)CCC(O)(Cc2ccc(I)cc2)C1 |
| InChI | InChI=1S/C14H19IO/c1-13(2)7-8-14(16,10-13)9-11-3-5-12(15)6-4-11/h3-6,16H,7-10H2,1-2H3 |
| InChIKey | RIZYGCWPDMQHQR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|