C20H23ClN4O — CID 11268730
3-(4-chlorophenyl)-6-methyl-9-pentan-3-yl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one (PubChem CID 11268730) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-6-methyl-9-pentan-3-yl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one.
| Compound Name | 3-(4-chlorophenyl)-6-methyl-9-pentan-3-yl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
|---|---|
| PubChem CID | 11268730 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-(4-chlorophenyl)-6-methyl-9-pentan-3-yl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
| SMILES | CCC(CC)N1CCn2c(=O)n(-c3ccc(Cl)cc3)c3nc(C)cc1c32 |
| InChI | InChI=1S/C20H23ClN4O/c1-4-15(5-2)23-10-11-24-18-17(23)12-13(3)22-19(18)25(20(24)26)16-8-6-14(21)7-9-16/h6-9,12,15H,4-5,10-11H2,1-3H3 |
| InChIKey | OQCPVMHNYALXOO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |