C11H8IN3S — CID 112692363
2-[(4-iodopyrazol-1-yl)methyl]-1,3-benzothiazole (PubChem CID 112692363) has the molecular formula C11H8IN3S and a molecular weight of 341.18 g/mol. Its IUPAC name is 2-[(4-iodopyrazol-1-yl)methyl]-1,3-benzothiazole.
| Compound Name | 2-[(4-iodopyrazol-1-yl)methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 112692363 |
| Molecular Formula | C11H8IN3S |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 340.95 |
| IUPAC Name | 2-[(4-iodopyrazol-1-yl)methyl]-1,3-benzothiazole |
| SMILES | Ic1cnn(Cc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C11H8IN3S/c12-8-5-13-15(6-8)7-11-14-9-3-1-2-4-10(9)16-11/h1-6H,7H2 |
| InChIKey | KKBPTVMRDGCWJE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|