C23H26N4O2 — CID 11269306
(2Z)-2-[(4-acetylphenyl)hydrazinylidene]-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-N,N-dimethylacetamide (PubChem CID 11269306) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is (2Z)-2-[(4-acetylphenyl)hydrazinylidene]-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-N,N-dimethylacetamide.
| Compound Name | (2Z)-2-[(4-acetylphenyl)hydrazinylidene]-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 11269306 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (2Z)-2-[(4-acetylphenyl)hydrazinylidene]-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-N,N-dimethylacetamide |
| SMILES | CC(=O)c1ccc(N/N=C(\C(=O)N(C)C)C2=NC(C)(C)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C23H26N4O2/c1-15(28)16-10-12-18(13-11-16)25-26-21(22(29)27(4)5)20-19-9-7-6-8-17(19)14-23(2,3)24-20/h6-13,25H,14H2,1-5H3/b26-21- |
| InChIKey | JVBWEXWINPQIBM-QLYXXIJNSA-N |
| XLogP | 3.57 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|