C11H11FN2 — CID 112695185
N-ethyl-7-fluoroquinolin-2-amine (PubChem CID 112695185) has the molecular formula C11H11FN2 and a molecular weight of 190.22 g/mol. Its IUPAC name is N-ethyl-7-fluoroquinolin-2-amine.
| Compound Name | N-ethyl-7-fluoroquinolin-2-amine |
|---|---|
| PubChem CID | 112695185 |
| Molecular Formula | C11H11FN2 |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N-ethyl-7-fluoroquinolin-2-amine |
| SMILES | CCNc1ccc2ccc(F)cc2n1 |
| InChI | InChI=1S/C11H11FN2/c1-2-13-11-6-4-8-3-5-9(12)7-10(8)14-11/h3-7H,2H2,1H3,(H,13,14) |
| InChIKey | DLCFINZCOAMJPV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |