C26H41NO2 — CID 11269561
(4R,5R)-5-pent-4-enyl-4-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one (PubChem CID 11269561) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is (4R,5R)-5-pent-4-enyl-4-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one.
| Compound Name | (4R,5R)-5-pent-4-enyl-4-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11269561 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | (4R,5R)-5-pent-4-enyl-4-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one |
| SMILES | C=CCCC[C@H]1NC(=O)C[C@H]1O[C@@H](C)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C26H41NO2/c1-9-10-11-12-23-24(15-25(28)27-23)29-19(8)26-21(17(4)5)13-20(16(2)3)14-22(26)18(6)7/h9,13-14,16-19,23-24H,1,10-12,15H2,2-8H3,(H,27,28)/t19-,23+,24+/m0/s1 |
| InChIKey | LICSBRWDMQHLSY-WUMKDDEVSA-N |
| XLogP | 6.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|