C9H21NO2S — CID 112704508
N-(2,2-dimethoxyethyl)-1-ethylsulfanylpropan-2-amine (PubChem CID 112704508) has the molecular formula C9H21NO2S and a molecular weight of 207.34 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-1-ethylsulfanylpropan-2-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-1-ethylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 112704508 |
| Molecular Formula | C9H21NO2S |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-1-ethylsulfanylpropan-2-amine |
| SMILES | CCSCC(C)NCC(OC)OC |
| InChI | InChI=1S/C9H21NO2S/c1-5-13-7-8(2)10-6-9(11-3)12-4/h8-10H,5-7H2,1-4H3 |
| InChIKey | XQFZSJBVLBSRKN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|